C14H22N2O2 — CID 60635323
1-(cyclopropylmethoxy)-3-(2-pyridin-2-ylethylamino)propan-2-ol (PubChem CID 60635323) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(cyclopropylmethoxy)-3-(2-pyridin-2-ylethylamino)propan-2-ol.
| Compound Name | 1-(cyclopropylmethoxy)-3-(2-pyridin-2-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60635323 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(cyclopropylmethoxy)-3-(2-pyridin-2-ylethylamino)propan-2-ol |
| SMILES | OC(CNCCc1ccccn1)COCC1CC1 |
| InChI | InChI=1S/C14H22N2O2/c17-14(11-18-10-12-4-5-12)9-15-8-6-13-3-1-2-7-16-13/h1-3,7,12,14-15,17H,4-6,8-11H2 |
| InChIKey | AHLMPPCGAHRZNN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|