C10H15NO2S — CID 79682874
3-(2-pyridin-2-ylethylsulfanyl)propane-1,2-diol (PubChem CID 79682874) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-(2-pyridin-2-ylethylsulfanyl)propane-1,2-diol.
| Compound Name | 3-(2-pyridin-2-ylethylsulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 79682874 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-(2-pyridin-2-ylethylsulfanyl)propane-1,2-diol |
| SMILES | OCC(O)CSCCc1ccccn1 |
| InChI | InChI=1S/C10H15NO2S/c12-7-10(13)8-14-6-4-9-3-1-2-5-11-9/h1-3,5,10,12-13H,4,6-8H2 |
| InChIKey | SNWWHLLSGYAOOJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|