C8H11NO2S2 — CID 125489143
(2R)-3-(pyridin-2-yldisulfanyl)propane-1,2-diol (PubChem CID 125489143) has the molecular formula C8H11NO2S2 and a molecular weight of 217.31 g/mol. Its IUPAC name is (2R)-3-(pyridin-2-yldisulfanyl)propane-1,2-diol.
| Compound Name | (2R)-3-(pyridin-2-yldisulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 125489143 |
| Molecular Formula | C8H11NO2S2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | (2R)-3-(pyridin-2-yldisulfanyl)propane-1,2-diol |
| SMILES | OC[C@@H](O)CSSc1ccccn1 |
| InChI | InChI=1S/C8H11NO2S2/c10-5-7(11)6-12-13-8-3-1-2-4-9-8/h1-4,7,10-11H,5-6H2/t7-/m1/s1 |
| InChIKey | RLDIKNMBHQFEQT-SSDOTTSWSA-N |
| XLogP | 1.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|