C9H13NO3S — CID 69497472
(2R,3R)-4-pyridin-2-ylsulfanylbutane-1,2,3-triol (PubChem CID 69497472) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (2R,3R)-4-pyridin-2-ylsulfanylbutane-1,2,3-triol.
| Compound Name | (2R,3R)-4-pyridin-2-ylsulfanylbutane-1,2,3-triol |
|---|---|
| PubChem CID | 69497472 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (2R,3R)-4-pyridin-2-ylsulfanylbutane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@@H](O)CSc1ccccn1 |
| InChI | InChI=1S/C9H13NO3S/c11-5-7(12)8(13)6-14-9-3-1-2-4-10-9/h1-4,7-8,11-13H,5-6H2/t7-,8+/m1/s1 |
| InChIKey | ZMGVTVHFTKAZKO-SFYZADRCSA-N |
| XLogP | -0.11 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |