C9H13NO2S — CID 79682125
3-(pyridin-2-ylmethylsulfanyl)propane-1,2-diol (PubChem CID 79682125) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 3-(pyridin-2-ylmethylsulfanyl)propane-1,2-diol.
| Compound Name | 3-(pyridin-2-ylmethylsulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 79682125 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 3-(pyridin-2-ylmethylsulfanyl)propane-1,2-diol |
| SMILES | OCC(O)CSCc1ccccn1 |
| InChI | InChI=1S/C9H13NO2S/c11-5-9(12)7-13-6-8-3-1-2-4-10-8/h1-4,9,11-12H,5-7H2 |
| InChIKey | FNKCNAGSVQGARB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |