C13H14FNO2S — CID 97079677
(2R)-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]propane-1,2-diol (PubChem CID 97079677) has the molecular formula C13H14FNO2S and a molecular weight of 267.32 g/mol. Its IUPAC name is (2R)-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]propane-1,2-diol.
| Compound Name | (2R)-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 97079677 |
| Molecular Formula | C13H14FNO2S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (2R)-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]propane-1,2-diol |
| SMILES | OC[C@@H](O)CSCc1cc(F)cc2cccnc12 |
| InChI | InChI=1S/C13H14FNO2S/c14-11-4-9-2-1-3-15-13(9)10(5-11)7-18-8-12(17)6-16/h1-5,12,16-17H,6-8H2/t12-/m1/s1 |
| InChIKey | MPILBEALYHEGQJ-GFCCVEGCSA-N |
| XLogP | 1.96 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |