C20H18F2N2OS — CID 87033588
N-[2-(4-fluorophenyl)ethyl]-2-[(6-fluoroquinolin-8-yl)methylsulfanyl]acetamide (PubChem CID 87033588) has the molecular formula C20H18F2N2OS and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-[(6-fluoroquinolin-8-yl)methylsulfanyl]acetamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-[(6-fluoroquinolin-8-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 87033588 |
| Molecular Formula | C20H18F2N2OS |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-[(6-fluoroquinolin-8-yl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1cc(F)cc2cccnc12)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H18F2N2OS/c21-17-5-3-14(4-6-17)7-9-23-19(25)13-26-12-16-11-18(22)10-15-2-1-8-24-20(15)16/h1-6,8,10-11H,7,9,12-13H2,(H,23,25) |
| InChIKey | NNUFXLCZBWIORG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |