C21H21FN4O2S — CID 30101688
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide (PubChem CID 30101688) has the molecular formula C21H21FN4O2S and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30101688 |
| Molecular Formula | C21H21FN4O2S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide |
| SMILES | O=C(CSCC(=O)Nc1ccc(F)cc1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H21FN4O2S/c22-17-4-6-18(7-5-17)25-21(28)15-29-14-20(27)23-12-10-16-2-8-19(9-3-16)26-13-1-11-24-26/h1-9,11,13H,10,12,14-15H2,(H,23,27)(H,25,28) |
| InChIKey | CSHICTAEOJRNOA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |