C24H22F2N2O2S — CID 39084029
4-[[2-(4-fluoroanilino)-2-oxoethyl]sulfanylmethyl]-N-[2-(4-fluorophenyl)ethyl]benzamide (PubChem CID 39084029) has the molecular formula C24H22F2N2O2S and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-[[2-(4-fluoroanilino)-2-oxoethyl]sulfanylmethyl]-N-[2-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | 4-[[2-(4-fluoroanilino)-2-oxoethyl]sulfanylmethyl]-N-[2-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 39084029 |
| Molecular Formula | C24H22F2N2O2S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 4-[[2-(4-fluoroanilino)-2-oxoethyl]sulfanylmethyl]-N-[2-(4-fluorophenyl)ethyl]benzamide |
| SMILES | O=C(CSCc1ccc(C(=O)NCCc2ccc(F)cc2)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H22F2N2O2S/c25-20-7-3-17(4-8-20)13-14-27-24(30)19-5-1-18(2-6-19)15-31-16-23(29)28-22-11-9-21(26)10-12-22/h1-12H,13-16H2,(H,27,30)(H,28,29) |
| InChIKey | NFYOZEKNUQOMDB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |