C17H19FN2O — CID 62185962
4-(ethylamino)-N-[2-(4-fluorophenyl)ethyl]benzamide (PubChem CID 62185962) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-(ethylamino)-N-[2-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | 4-(ethylamino)-N-[2-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 62185962 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4-(ethylamino)-N-[2-(4-fluorophenyl)ethyl]benzamide |
| SMILES | CCNc1ccc(C(=O)NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H19FN2O/c1-2-19-16-9-5-14(6-10-16)17(21)20-12-11-13-3-7-15(18)8-4-13/h3-10,19H,2,11-12H2,1H3,(H,20,21) |
| InChIKey | DUNJOMXCOSDLBT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |