C16H14FNO2 — CID 87952019
N-[2-(4-fluorophenyl)ethyl]-4-formylbenzamide (PubChem CID 87952019) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-formylbenzamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-formylbenzamide |
|---|---|
| PubChem CID | 87952019 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-formylbenzamide |
| SMILES | O=Cc1ccc(C(=O)NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H14FNO2/c17-15-7-3-12(4-8-15)9-10-18-16(20)14-5-1-13(11-19)2-6-14/h1-8,11H,9-10H2,(H,18,20) |
| InChIKey | PFVUKYABZKQOCV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|