C17H13F6NO — CID 86613992
N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide (PubChem CID 86613992) has the molecular formula C17H13F6NO and a molecular weight of 361.29 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide |
|---|---|
| PubChem CID | 86613992 |
| Molecular Formula | C17H13F6NO |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F6NO/c18-14-7-1-11(2-8-14)9-10-24-15(25)12-3-5-13(6-4-12)16(19,20)17(21,22)23/h1-8H,9-10H2,(H,24,25) |
| InChIKey | NHDPKWTYJNFXDK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|