C26H18F11NO3 — CID 161150269
N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide;4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 161150269) has the molecular formula C26H18F11NO3 and a molecular weight of 601.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide;4-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide;4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 161150269 |
| Molecular Formula | C26H18F11NO3 |
| Molecular Weight | 601.41 g/mol |
| Exact Mass | 601.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-(1,1,2,2,2-pentafluoroethyl)benzamide;4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc(C(F)(F)C(F)(F)F)cc1.O=C(O)c1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F6NO.C9H5F5O2/c18-14-7-1-11(2-8-14)9-10-24-15(25)12-3-5-13(6-4-12)16(19,20)17(21,22)23;10-8(11,9(12,13)14)6-3-1-5(2-4-6)7(15)16/h1-8H,9-10H2,(H,24,25);1-4H,(H,15,16) |
| InChIKey | UOOWWCJMLXQYSN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.41 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|