C16H13F2NO3 — CID 71894222
4-[2-[(2,5-difluorobenzoyl)amino]ethyl]benzoic acid (PubChem CID 71894222) has the molecular formula C16H13F2NO3 and a molecular weight of 305.28 g/mol. Its IUPAC name is 4-[2-[(2,5-difluorobenzoyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2,5-difluorobenzoyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 71894222 |
| Molecular Formula | C16H13F2NO3 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[2-[(2,5-difluorobenzoyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNC(=O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C16H13F2NO3/c17-12-5-6-14(18)13(9-12)15(20)19-8-7-10-1-3-11(4-2-10)16(21)22/h1-6,9H,7-8H2,(H,19,20)(H,21,22) |
| InChIKey | YRTSTBQHZIMFBW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |