C19H22FN3O2 — CID 119548004
N-[4-[2-(4-aminophenyl)ethylamino]-4-oxobutyl]-4-fluorobenzamide (PubChem CID 119548004) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-[4-[2-(4-aminophenyl)ethylamino]-4-oxobutyl]-4-fluorobenzamide.
| Compound Name | N-[4-[2-(4-aminophenyl)ethylamino]-4-oxobutyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 119548004 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[4-[2-(4-aminophenyl)ethylamino]-4-oxobutyl]-4-fluorobenzamide |
| SMILES | Nc1ccc(CCNC(=O)CCCNC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FN3O2/c20-16-7-5-15(6-8-16)19(25)23-12-1-2-18(24)22-13-11-14-3-9-17(21)10-4-14/h3-10H,1-2,11-13,21H2,(H,22,24)(H,23,25) |
| InChIKey | NVVFUWKQQUUIRI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|