C17H18FN3O2S — CID 55555065
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(2-pyridin-3-ylethyl)acetamide (PubChem CID 55555065) has the molecular formula C17H18FN3O2S and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(2-pyridin-3-ylethyl)acetamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(2-pyridin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 55555065 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(2-pyridin-3-ylethyl)acetamide |
| SMILES | O=C(CSCC(=O)Nc1ccc(F)cc1)NCCc1cccnc1 |
| InChI | InChI=1S/C17H18FN3O2S/c18-14-3-5-15(6-4-14)21-17(23)12-24-11-16(22)20-9-7-13-2-1-8-19-10-13/h1-6,8,10H,7,9,11-12H2,(H,20,22)(H,21,23) |
| InChIKey | UHBBADVBTYLSRJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |