C12H13FN2 — CID 82576719
3-(6-fluoroquinolin-8-yl)propan-1-amine (PubChem CID 82576719) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-(6-fluoroquinolin-8-yl)propan-1-amine.
| Compound Name | 3-(6-fluoroquinolin-8-yl)propan-1-amine |
|---|---|
| PubChem CID | 82576719 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 3-(6-fluoroquinolin-8-yl)propan-1-amine |
| SMILES | NCCCc1cc(F)cc2cccnc12 |
| InChI | InChI=1S/C12H13FN2/c13-11-7-9(3-1-5-14)12-10(8-11)4-2-6-15-12/h2,4,6-8H,1,3,5,14H2 |
| InChIKey | BZPBWCYHPCPWMO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |