C15H17FN2O2S — CID 106442635
(2R)-2-amino-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 106442635) has the molecular formula C15H17FN2O2S and a molecular weight of 308.38 g/mol. Its IUPAC name is (2R)-2-amino-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106442635 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2R)-2-amino-3-[(6-fluoroquinolin-8-yl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)(SCc1cc(F)cc2cccnc12)[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H17FN2O2S/c1-15(2,13(17)14(19)20)21-8-10-7-11(16)6-9-4-3-5-18-12(9)10/h3-7,13H,8,17H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | SZAFLYHUFQMQFI-CYBMUJFWSA-N |
| XLogP | 2.80 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |