C12H15N3O2S — CID 114189359
(2S)-2-amino-3-[(2-cyano-4-pyridinyl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 114189359) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2-cyano-4-pyridinyl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[(2-cyano-4-pyridinyl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 114189359 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (2S)-2-amino-3-[(2-cyano-4-pyridinyl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)(SCc1ccnc(C#N)c1)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C12H15N3O2S/c1-12(2,10(14)11(16)17)18-7-8-3-4-15-9(5-8)6-13/h3-5,10H,7,14H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | UJWUZQOOBBYTPV-JTQLQIEISA-N |
| XLogP | 1.38 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |