C12H15BrFNO2S — CID 106443915
(2S)-2-amino-3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 106443915) has the molecular formula C12H15BrFNO2S and a molecular weight of 336.23 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443915 |
| Molecular Formula | C12H15BrFNO2S |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | (2S)-2-amino-3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)(SCc1cccc(F)c1Br)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C12H15BrFNO2S/c1-12(2,10(15)11(16)17)18-6-7-4-3-5-8(14)9(7)13/h3-5,10H,6,15H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | BWIADANLWQZFEV-JTQLQIEISA-N |
| XLogP | 3.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |