C13H18FNO2S2 — CID 114189214
(2R)-2-amino-3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-methylbutanoic acid (PubChem CID 114189214) has the molecular formula C13H18FNO2S2 and a molecular weight of 303.42 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 114189214 |
| Molecular Formula | C13H18FNO2S2 |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2R)-2-amino-3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)(SCCSc1ccccc1F)[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H18FNO2S2/c1-13(2,11(15)12(16)17)19-8-7-18-10-6-4-3-5-9(10)14/h3-6,11H,7-8,15H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | VYVNVFZMCVUZKR-LLVKDONJSA-N |
| XLogP | 2.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|