C14H20N2O3S2 — CID 106442887
(2R)-2-amino-3-methyl-3-[2-(2-methylsulfanylanilino)-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 106442887) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-3-[2-(2-methylsulfanylanilino)-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | (2R)-2-amino-3-methyl-3-[2-(2-methylsulfanylanilino)-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 106442887 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (2R)-2-amino-3-methyl-3-[2-(2-methylsulfanylanilino)-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | CSc1ccccc1NC(=O)CSC(C)(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H20N2O3S2/c1-14(2,12(15)13(18)19)21-8-11(17)16-9-6-4-5-7-10(9)20-3/h4-7,12H,8,15H2,1-3H3,(H,16,17)(H,18,19)/t12-/m1/s1 |
| InChIKey | WBPAEJKZFHVDSK-GFCCVEGCSA-N |
| XLogP | 2.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |