C15H22FNO2S — CID 79381435
N-ethyl-3-(2-fluorophenyl)sulfanyl-N-(2-hydroxy-2-methylpropyl)propanamide (PubChem CID 79381435) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is N-ethyl-3-(2-fluorophenyl)sulfanyl-N-(2-hydroxy-2-methylpropyl)propanamide.
| Compound Name | N-ethyl-3-(2-fluorophenyl)sulfanyl-N-(2-hydroxy-2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 79381435 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-ethyl-3-(2-fluorophenyl)sulfanyl-N-(2-hydroxy-2-methylpropyl)propanamide |
| SMILES | CCN(CC(C)(C)O)C(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C15H22FNO2S/c1-4-17(11-15(2,3)19)14(18)9-10-20-13-8-6-5-7-12(13)16/h5-8,19H,4,9-11H2,1-3H3 |
| InChIKey | BVSNZTJOIKJQPB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |