C10H15NO2S2 — CID 106443253
(2S)-2-amino-3-methyl-3-(thiophen-3-ylmethylsulfanyl)butanoic acid (PubChem CID 106443253) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-3-(thiophen-3-ylmethylsulfanyl)butanoic acid.
| Compound Name | (2S)-2-amino-3-methyl-3-(thiophen-3-ylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 106443253 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (2S)-2-amino-3-methyl-3-(thiophen-3-ylmethylsulfanyl)butanoic acid |
| SMILES | CC(C)(SCc1ccsc1)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C10H15NO2S2/c1-10(2,8(11)9(12)13)15-6-7-3-4-14-5-7/h3-5,8H,6,11H2,1-2H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | YQFNFNBZRZEIMZ-QMMMGPOBSA-N |
| XLogP | 2.17 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |