C10H14BrNO2S2 — CID 106443373
(2S)-2-amino-3-[(4-bromothiophen-2-yl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 106443373) has the molecular formula C10H14BrNO2S2 and a molecular weight of 324.27 g/mol. Its IUPAC name is (2S)-2-amino-3-[(4-bromothiophen-2-yl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[(4-bromothiophen-2-yl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443373 |
| Molecular Formula | C10H14BrNO2S2 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | (2S)-2-amino-3-[(4-bromothiophen-2-yl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)(SCc1cc(Br)cs1)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C10H14BrNO2S2/c1-10(2,8(12)9(13)14)16-5-7-3-6(11)4-15-7/h3-4,8H,5,12H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | SJQAKYZLGKGLOR-QMMMGPOBSA-N |
| XLogP | 2.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |