C10H16ClNO2S2 — CID 70050788
ethyl (2R)-2-amino-3-(thiophen-3-ylmethylsulfanyl)propanoate;hydrochloride (PubChem CID 70050788) has the molecular formula C10H16ClNO2S2 and a molecular weight of 281.83 g/mol. Its IUPAC name is ethyl (2R)-2-amino-3-(thiophen-3-ylmethylsulfanyl)propanoate;hydrochloride.
| Compound Name | ethyl (2R)-2-amino-3-(thiophen-3-ylmethylsulfanyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 70050788 |
| Molecular Formula | C10H16ClNO2S2 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | ethyl (2R)-2-amino-3-(thiophen-3-ylmethylsulfanyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](N)CSCc1ccsc1.Cl |
| InChI | InChI=1S/C10H15NO2S2.ClH/c1-2-13-10(12)9(11)7-15-6-8-3-4-14-5-8;/h3-5,9H,2,6-7,11H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | BLMATXWGVXKZPP-FVGYRXGTSA-N |
| XLogP | 2.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |