C13H15FN2O2S — CID 107881654
ethyl 2-amino-3-[(3-cyano-4-fluorophenyl)methylsulfanyl]propanoate (PubChem CID 107881654) has the molecular formula C13H15FN2O2S and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 2-amino-3-[(3-cyano-4-fluorophenyl)methylsulfanyl]propanoate.
| Compound Name | ethyl 2-amino-3-[(3-cyano-4-fluorophenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 107881654 |
| Molecular Formula | C13H15FN2O2S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | ethyl 2-amino-3-[(3-cyano-4-fluorophenyl)methylsulfanyl]propanoate |
| SMILES | CCOC(=O)C(N)CSCc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H15FN2O2S/c1-2-18-13(17)12(16)8-19-7-9-3-4-11(14)10(5-9)6-15/h3-5,12H,2,7-8,16H2,1H3 |
| InChIKey | YKGWSLCBUYNYJI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |