C12H19NO2S — CID 64660856
ethyl 2-[methyl(thiophen-3-ylmethyl)amino]butanoate (PubChem CID 64660856) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is ethyl 2-[methyl(thiophen-3-ylmethyl)amino]butanoate.
| Compound Name | ethyl 2-[methyl(thiophen-3-ylmethyl)amino]butanoate |
|---|---|
| PubChem CID | 64660856 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethyl 2-[methyl(thiophen-3-ylmethyl)amino]butanoate |
| SMILES | CCOC(=O)C(CC)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C12H19NO2S/c1-4-11(12(14)15-5-2)13(3)8-10-6-7-16-9-10/h6-7,9,11H,4-5,8H2,1-3H3 |
| InChIKey | UUVRQYZILSZKAN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |