C9H15N3OS — CID 55215186
2-[methyl(thiophen-3-ylmethyl)amino]propanehydrazide (PubChem CID 55215186) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-[methyl(thiophen-3-ylmethyl)amino]propanehydrazide.
| Compound Name | 2-[methyl(thiophen-3-ylmethyl)amino]propanehydrazide |
|---|---|
| PubChem CID | 55215186 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[methyl(thiophen-3-ylmethyl)amino]propanehydrazide |
| SMILES | CC(C(=O)NN)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C9H15N3OS/c1-7(9(13)11-10)12(2)5-8-3-4-14-6-8/h3-4,6-7H,5,10H2,1-2H3,(H,11,13) |
| InChIKey | KSLUADIEFLEOCF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|