C16H17F3N2OS — CID 25476161
(2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 25476161) has the molecular formula C16H17F3N2OS and a molecular weight of 342.39 g/mol. Its IUPAC name is (2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 25476161 |
| Molecular Formula | C16H17F3N2OS |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(C(F)(F)F)c1)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C16H17F3N2OS/c1-11(21(2)9-12-6-7-23-10-12)15(22)20-14-5-3-4-13(8-14)16(17,18)19/h3-8,10-11H,9H2,1-2H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | SGVQNUIBOBISNN-LLVKDONJSA-N |
| XLogP | 4.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |