C17H24F3N3O2 — CID 97067662
(2S)-2-[methyl(2-morpholin-4-ylethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 97067662) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is (2S)-2-[methyl(2-morpholin-4-ylethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-[methyl(2-morpholin-4-ylethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 97067662 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (2S)-2-[methyl(2-morpholin-4-ylethyl)amino]-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(C(F)(F)F)c1)N(C)CCN1CCOCC1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-13(22(2)6-7-23-8-10-25-11-9-23)16(24)21-15-5-3-4-14(12-15)17(18,19)20/h3-5,12-13H,6-11H2,1-2H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | HFLLNUYGJAGXMC-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |