C16H20F3N3O3 — CID 108944086
N-(2-morpholin-4-ylethyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108944086) has the molecular formula C16H20F3N3O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108944086 |
| Molecular Formula | C16H20F3N3O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(C(F)(F)F)c1)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H20F3N3O3/c17-16(18,19)12-2-1-3-13(10-12)21-15(24)11-14(23)20-4-5-22-6-8-25-9-7-22/h1-3,10H,4-9,11H2,(H,20,23)(H,21,24) |
| InChIKey | LPXBIJWOFKIEHH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|