C18H20F3N5O2 — CID 109344513
6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109344513) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109344513 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cc(NCCN2CCOCC2)ncn1 |
| InChI | InChI=1S/C18H20F3N5O2/c19-18(20,21)13-2-1-3-14(10-13)25-17(27)15-11-16(24-12-23-15)22-4-5-26-6-8-28-9-7-26/h1-3,10-12H,4-9H2,(H,25,27)(H,22,23,24) |
| InChIKey | JITVMCXRYAAJTI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |