C19H21F3N4O2 — CID 109154066
6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 109154066) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109154066 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 6-(2-morpholin-4-ylethylamino)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(NCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C19H21F3N4O2/c20-19(21,22)15-2-1-3-16(12-15)25-18(27)14-4-5-17(24-13-14)23-6-7-26-8-10-28-11-9-26/h1-5,12-13H,6-11H2,(H,23,24)(H,25,27) |
| InChIKey | XGRHFORZCBGBNU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |