C15H19F3N4O2 — CID 108501365
N-(2-piperazin-1-ylethyl)-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 108501365) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(2-piperazin-1-ylethyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108501365 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(NCCN1CCNCC1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N4O2/c16-15(17,18)11-2-1-3-12(10-11)21-14(24)13(23)20-6-9-22-7-4-19-5-8-22/h1-3,10,19H,4-9H2,(H,20,23)(H,21,24) |
| InChIKey | RSXXAHBCGMNGSX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|