C13H15F3N2O3 — CID 3114001
N-(3-methoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 3114001) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(3-methoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 3114001 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-(3-methoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | COCCCNC(=O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-21-7-3-6-17-11(19)12(20)18-10-5-2-4-9(8-10)13(14,15)16/h2,4-5,8H,3,6-7H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | YSWJYNQVKKXDDQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|