C16H17F3N4O2 — CID 109251795
N-(3-methoxypropyl)-2-[3-(trifluoromethyl)anilino]pyrimidine-5-carboxamide (PubChem CID 109251795) has the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[3-(trifluoromethyl)anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-[3-(trifluoromethyl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109251795 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(3-methoxypropyl)-2-[3-(trifluoromethyl)anilino]pyrimidine-5-carboxamide |
| SMILES | COCCCNC(=O)c1cnc(Nc2cccc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C16H17F3N4O2/c1-25-7-3-6-20-14(24)11-9-21-15(22-10-11)23-13-5-2-4-12(8-13)16(17,18)19/h2,4-5,8-10H,3,6-7H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | XGDZIPJUCILPIW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|