C17H19F3N4O2 — CID 109365282
N-(3-methoxypropyl)-2-methyl-6-[3-(trifluoromethyl)anilino]pyrimidine-4-carboxamide (PubChem CID 109365282) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-methyl-6-[3-(trifluoromethyl)anilino]pyrimidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-methyl-6-[3-(trifluoromethyl)anilino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109365282 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(3-methoxypropyl)-2-methyl-6-[3-(trifluoromethyl)anilino]pyrimidine-4-carboxamide |
| SMILES | COCCCNC(=O)c1cc(Nc2cccc(C(F)(F)F)c2)nc(C)n1 |
| InChI | InChI=1S/C17H19F3N4O2/c1-11-22-14(16(25)21-7-4-8-26-2)10-15(23-11)24-13-6-3-5-12(9-13)17(18,19)20/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,21,25)(H,22,23,24) |
| InChIKey | NFKMOINGQJWYHY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|