C21H25F3N2O2 — CID 108882674
1-[3-(4-tert-butylphenoxy)propyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 108882674) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenoxy)propyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(4-tert-butylphenoxy)propyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108882674 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[3-(4-tert-butylphenoxy)propyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-20(2,3)15-8-10-18(11-9-15)28-13-5-12-25-19(27)26-17-7-4-6-16(14-17)21(22,23)24/h4,6-11,14H,5,12-13H2,1-3H3,(H2,25,26,27) |
| InChIKey | FIKHJYKIJJXSGJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|