C19H18F6N2O2 — CID 108881416
1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea (PubChem CID 108881416) has the molecular formula C19H18F6N2O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108881416 |
| Molecular Formula | C19H18F6N2O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea |
| SMILES | Cc1ccc(OCCCNC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H18F6N2O2/c1-12-3-5-16(6-4-12)29-8-2-7-26-17(28)27-15-10-13(18(20,21)22)9-14(11-15)19(23,24)25/h3-6,9-11H,2,7-8H2,1H3,(H2,26,27,28) |
| InChIKey | KKPJLYKUOUYWOO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|