C23H32N2O3 — CID 47093546
1,3-bis[4-(4-methylphenoxy)butyl]urea (PubChem CID 47093546) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1,3-bis[4-(4-methylphenoxy)butyl]urea.
| Compound Name | 1,3-bis[4-(4-methylphenoxy)butyl]urea |
|---|---|
| PubChem CID | 47093546 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1,3-bis[4-(4-methylphenoxy)butyl]urea |
| SMILES | Cc1ccc(OCCCCNC(=O)NCCCCOc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-19-7-11-21(12-8-19)27-17-5-3-15-24-23(26)25-16-4-6-18-28-22-13-9-20(2)10-14-22/h7-14H,3-6,15-18H2,1-2H3,(H2,24,25,26) |
| InChIKey | FIVWJFNAPDPSCA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|