C15H24N2O3 — CID 108881485
1-(1-hydroxy-2-methylpropan-2-yl)-3-[3-(4-methylphenoxy)propyl]urea (PubChem CID 108881485) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpropan-2-yl)-3-[3-(4-methylphenoxy)propyl]urea.
| Compound Name | 1-(1-hydroxy-2-methylpropan-2-yl)-3-[3-(4-methylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108881485 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(1-hydroxy-2-methylpropan-2-yl)-3-[3-(4-methylphenoxy)propyl]urea |
| SMILES | Cc1ccc(OCCCNC(=O)NC(C)(C)CO)cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-12-5-7-13(8-6-12)20-10-4-9-16-14(19)17-15(2,3)11-18/h5-8,18H,4,9-11H2,1-3H3,(H2,16,17,19) |
| InChIKey | UJYMSVCSXFCKNX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|