C14H19F2NO3 — CID 104857867
N-(2,2-difluoro-3-hydroxypropyl)-4-(4-methylphenoxy)butanamide (PubChem CID 104857867) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-4-(4-methylphenoxy)butanamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 104857867 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-4-(4-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)NCC(F)(F)CO)cc1 |
| InChI | InChI=1S/C14H19F2NO3/c1-11-4-6-12(7-5-11)20-8-2-3-13(19)17-9-14(15,16)10-18/h4-7,18H,2-3,8-10H2,1H3,(H,17,19) |
| InChIKey | JKPYLNOWFZMDQW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|