C18H26F3NO3 — CID 97247433
4-(4-tert-butylphenoxy)-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]butanamide (PubChem CID 97247433) has the molecular formula C18H26F3NO3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]butanamide |
|---|---|
| PubChem CID | 97247433 |
| Molecular Formula | C18H26F3NO3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)NC[C@@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H26F3NO3/c1-16(2,3)13-7-9-14(10-8-13)25-11-5-6-15(23)22-12-17(4,24)18(19,20)21/h7-10,24H,5-6,11-12H2,1-4H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | XWQRSZSOWMSKOE-QGZVFWFLSA-N |
| XLogP | 3.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|