C19H32N2O2 — CID 108881373
1-[3-(4-methylphenoxy)propyl]-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 108881373) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[3-(4-methylphenoxy)propyl]-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-[3-(4-methylphenoxy)propyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 108881373 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-[3-(4-methylphenoxy)propyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | Cc1ccc(OCCCNC(=O)NC(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O2/c1-15-8-10-16(11-9-15)23-13-7-12-20-17(22)21-19(5,6)14-18(2,3)4/h8-11H,7,12-14H2,1-6H3,(H2,20,21,22) |
| InChIKey | QAMHJOQMFGBDQA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|