C18H30N2O2 — CID 108882694
1-butyl-3-[3-(4-tert-butylphenoxy)propyl]urea (PubChem CID 108882694) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-butyl-3-[3-(4-tert-butylphenoxy)propyl]urea.
| Compound Name | 1-butyl-3-[3-(4-tert-butylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108882694 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-butyl-3-[3-(4-tert-butylphenoxy)propyl]urea |
| SMILES | CCCCNC(=O)NCCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N2O2/c1-5-6-12-19-17(21)20-13-7-14-22-16-10-8-15(9-11-16)18(2,3)4/h8-11H,5-7,12-14H2,1-4H3,(H2,19,20,21) |
| InChIKey | UAROLSMXIOPOCL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|