C20H35N3O2 — CID 108882809
1-[3-(4-tert-butylphenoxy)propyl]-3-[2-(diethylamino)ethyl]urea (PubChem CID 108882809) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenoxy)propyl]-3-[2-(diethylamino)ethyl]urea.
| Compound Name | 1-[3-(4-tert-butylphenoxy)propyl]-3-[2-(diethylamino)ethyl]urea |
|---|---|
| PubChem CID | 108882809 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 1-[3-(4-tert-butylphenoxy)propyl]-3-[2-(diethylamino)ethyl]urea |
| SMILES | CCN(CC)CCNC(=O)NCCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H35N3O2/c1-6-23(7-2)15-14-22-19(24)21-13-8-16-25-18-11-9-17(10-12-18)20(3,4)5/h9-12H,6-8,13-16H2,1-5H3,(H2,21,22,24) |
| InChIKey | MLQWKROLUYDTMH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|