C21H27BrN2O2 — CID 108882982
1-[(4-bromophenyl)methyl]-3-[3-(4-tert-butylphenoxy)propyl]urea (PubChem CID 108882982) has the molecular formula C21H27BrN2O2 and a molecular weight of 419.36 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[3-(4-tert-butylphenoxy)propyl]urea.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[3-(4-tert-butylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108882982 |
| Molecular Formula | C21H27BrN2O2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[3-(4-tert-butylphenoxy)propyl]urea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)NCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H27BrN2O2/c1-21(2,3)17-7-11-19(12-8-17)26-14-4-13-23-20(25)24-15-16-5-9-18(22)10-6-16/h5-12H,4,13-15H2,1-3H3,(H2,23,24,25) |
| InChIKey | BRPORCWFUKIMKO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|