C34H30F18N7O3+ — CID 171057113
tris[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]ethyl]-methylazanium (PubChem CID 171057113) has the molecular formula C34H30F18N7O3+ and a molecular weight of 926.62 g/mol. Its IUPAC name is tris[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]ethyl]-methylazanium.
| Compound Name | tris[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]ethyl]-methylazanium |
|---|---|
| PubChem CID | 171057113 |
| Molecular Formula | C34H30F18N7O3+ |
| Molecular Weight | 926.62 g/mol |
| Exact Mass | 926.21 |
| IUPAC Name | tris[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]ethyl]-methylazanium |
| SMILES | C[N+](CCNC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(CCNC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)CCNC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H29F18N7O3/c1-59(5-2-53-26(60)56-23-11-17(29(35,36)37)8-18(12-23)30(38,39)40,6-3-54-27(61)57-24-13-19(31(41,42)43)9-20(14-24)32(44,45)46)7-4-55-28(62)58-25-15-21(33(47,48)49)10-22(16-25)34(50,51)52/h8-16H,2-7H2,1H3,(H5-,53,54,55,56,57,58,60,61,62)/p+1 |
| InChIKey | KQDGGEZJMFSTDD-UHFFFAOYSA-O |
| XLogP | 10.01 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.62 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|