C17H13BrF6N2O — CID 108900585
1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(2-bromophenyl)ethyl]urea (PubChem CID 108900585) has the molecular formula C17H13BrF6N2O and a molecular weight of 455.20 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(2-bromophenyl)ethyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(2-bromophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108900585 |
| Molecular Formula | C17H13BrF6N2O |
| Molecular Weight | 455.20 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(2-bromophenyl)ethyl]urea |
| SMILES | O=C(NCCc1ccccc1Br)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13BrF6N2O/c18-14-4-2-1-3-10(14)5-6-25-15(27)26-13-8-11(16(19,20)21)7-12(9-13)17(22,23)24/h1-4,7-9H,5-6H2,(H2,25,26,27) |
| InChIKey | FIIDAJJFVHWUQV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.20 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |